About 2-[5-(aminomethyl)-1,2-dihydrotriazol-3-yl]-N,N-dimethylacetamide
2-[5-(aminomethyl)-1,2-dihydrotriazol-3-yl]-N,N-dimethylacetamide (PubChem CID 146482296) has the molecular formula C7H15N5O
and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-[5-(aminomethyl)-1,2-dihydrotriazol-3-yl]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[5-(aminomethyl)-1,2-dihydrotriazol-3-yl]-N,N-dimethylacetamide |
| PubChem CID | 146482296 |
| Molecular Formula | C7H15N5O |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | 2-[5-(aminomethyl)-1,2-dihydrotriazol-3-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1C=C(CN)NN1 |
| InChI | InChI=1S/C7H15N5O/c1-11(2)7(13)5-12-4-6(3-8)9-10-12/h4,9-10H,3,5,8H2,1-2H3 |
| InChIKey | BDFGHUXRZCATFI-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(aminomethyl)-1,2-dihydrotriazol-3-yl]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(aminomethyl)-1,2-dihydrotriazol-3-yl]-N,N-dimethylacetamide?
The IUPAC name of 2-[5-(aminomethyl)-1,2-dihydrotriazol-3-yl]-N,N-dimethylacetamide (CID 146482296) is 2-[5-(aminomethyl)-1,2-dihydrotriazol-3-yl]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[5-(aminomethyl)-1,2-dihydrotriazol-3-yl]-N,N-dimethylacetamide?
The canonical SMILES for 2-[5-(aminomethyl)-1,2-dihydrotriazol-3-yl]-N,N-dimethylacetamide is CN(C)C(=O)CN1C=C(CN)NN1.
What is the InChIKey of 2-[5-(aminomethyl)-1,2-dihydrotriazol-3-yl]-N,N-dimethylacetamide?
The InChIKey is BDFGHUXRZCATFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N5O/c1-11(2)7(13)5-12-4-6(3-8)9-10-12/h4,9-10H,3,5,8H2,1-2H3.
What are the key properties of 2-[5-(aminomethyl)-1,2-dihydrotriazol-3-yl]-N,N-dimethylacetamide?
2-[5-(aminomethyl)-1,2-dihydrotriazol-3-yl]-N,N-dimethylacetamide has a molecular weight of 185.23 g/mol, XLogP of -1.80, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(aminomethyl)-1,2-dihydrotriazol-3-yl]-N,N-dimethylacetamide is sourced from PubChem (CID 146482296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).