About 3-fluoro-6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine
3-fluoro-6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine (PubChem CID 146482438) has the molecular formula C5H6FN5
and a molecular weight of 155.14 g/mol. Its IUPAC name is 3-fluoro-6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine.
Molecular Properties
| Compound Name | 3-fluoro-6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine |
| PubChem CID | 146482438 |
| Molecular Formula | C5H6FN5 |
| Molecular Weight | 155.14 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 3-fluoro-6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine |
| SMILES | Cc1[nH]n2c(F)nnc2c1N |
| InChI | InChI=1S/C5H6FN5/c1-2-3(7)4-8-9-5(6)11(4)10-2/h10H,7H2,1H3 |
| InChIKey | KAEREHCBIWQRCR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.14 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-fluoro-6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine?
The IUPAC name of 3-fluoro-6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine (CID 146482438) is 3-fluoro-6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine.
What is the SMILES notation for 3-fluoro-6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine?
The canonical SMILES for 3-fluoro-6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine is Cc1[nH]n2c(F)nnc2c1N.
What is the InChIKey of 3-fluoro-6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine?
The InChIKey is KAEREHCBIWQRCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6FN5/c1-2-3(7)4-8-9-5(6)11(4)10-2/h10H,7H2,1H3.
What are the key properties of 3-fluoro-6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine?
3-fluoro-6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine has a molecular weight of 155.14 g/mol, XLogP of 0.09, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine is sourced from PubChem (CID 146482438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).