C27H32N2O2 — CID 146482588
3-[(3E,5E)-5-[5-[(1Z)-buta-1,3-dienyl]-6-ethenyl-2,4-dihydro-1,3-oxazin-3-yl]octa-1,3,5,7-tetraen-3-yl]-5-ethenyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine (PubChem CID 146482588) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 3-[(3E,5E)-5-[5-[(1Z)-buta-1,3-dienyl]-6-ethenyl-2,4-dihydro-1,3-oxazin-3-yl]octa-1,3,5,7-tetraen-3-yl]-5-ethenyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine.
| Compound Name | 3-[(3E,5E)-5-[5-[(1Z)-buta-1,3-dienyl]-6-ethenyl-2,4-dihydro-1,3-oxazin-3-yl]octa-1,3,5,7-tetraen-3-yl]-5-ethenyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine |
|---|---|
| PubChem CID | 146482588 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 3-[(3E,5E)-5-[5-[(1Z)-buta-1,3-dienyl]-6-ethenyl-2,4-dihydro-1,3-oxazin-3-yl]octa-1,3,5,7-tetraen-3-yl]-5-ethenyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine |
| SMILES | C=C/C=C\C1=C(C=C)OCN(C(/C=C(\C=C)N2COC(/C=C\C)=C(C=C)C2)=C/C=C)C1 |
| InChI | InChI=1S/C27H32N2O2/c1-7-13-16-23-19-29(21-30-26(23)12-6)25(14-8-2)17-24(11-5)28-18-22(10-4)27(15-9-3)31-20-28/h7-17H,1-2,4-6,18-21H2,3H3/b15-9-,16-13-,24-17+,25-14+ |
| InChIKey | HBMXRDPSDABZHU-NVVNZLEKSA-N |
| XLogP | 5.90 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|