C25H38N4O4 — CID 146483362
(2S)-2-[(1-acetylpiperidine-4-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 146483362) has the molecular formula C25H38N4O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is (2S)-2-[(1-acetylpiperidine-4-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | (2S)-2-[(1-acetylpiperidine-4-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 146483362 |
| Molecular Formula | C25H38N4O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | (2S)-2-[(1-acetylpiperidine-4-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | CC(=O)N1CCC(C(=O)N[C@@H](CCCCCCCc2ccc3c(n2)NCCC3)C(=O)O)CC1 |
| InChI | InChI=1S/C25H38N4O4/c1-18(30)29-16-13-20(14-17-29)24(31)28-22(25(32)33)10-6-4-2-3-5-9-21-12-11-19-8-7-15-26-23(19)27-21/h11-12,20,22H,2-10,13-17H2,1H3,(H,26,27)(H,28,31)(H,32,33)/t22-/m0/s1 |
| InChIKey | GUCBAXFWYJLSOM-QFIPXVFZSA-N |
| XLogP | 3.15 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|