C27H35N3O4 — CID 146483524
(2S)-2-[[(4S)-3,4-dihydro-2H-chromene-4-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 146483524) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is (2S)-2-[[(4S)-3,4-dihydro-2H-chromene-4-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | (2S)-2-[[(4S)-3,4-dihydro-2H-chromene-4-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 146483524 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | (2S)-2-[[(4S)-3,4-dihydro-2H-chromene-4-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | O=C(O)[C@H](CCCCCCCc1ccc2c(n1)NCCC2)NC(=O)[C@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C27H35N3O4/c31-26(22-16-18-34-24-13-7-6-11-21(22)24)30-23(27(32)33)12-5-3-1-2-4-10-20-15-14-19-9-8-17-28-25(19)29-20/h6-7,11,13-15,22-23H,1-5,8-10,12,16-18H2,(H,28,29)(H,30,31)(H,32,33)/t22-,23-/m0/s1 |
| InChIKey | OBDVYLFPUNJSTA-GOTSBHOMSA-N |
| XLogP | 4.46 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|