C23H25Cl3N2O4S — CID 146484282
N-[[3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenyl]-1,2-oxazol-5-yl]methyl]methanesulfonamide (PubChem CID 146484282) has the molecular formula C23H25Cl3N2O4S and a molecular weight of 531.89 g/mol. Its IUPAC name is N-[[3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenyl]-1,2-oxazol-5-yl]methyl]methanesulfonamide.
| Compound Name | N-[[3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenyl]-1,2-oxazol-5-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 146484282 |
| Molecular Formula | C23H25Cl3N2O4S |
| Molecular Weight | 531.89 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | N-[[3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenyl]-1,2-oxazol-5-yl]methyl]methanesulfonamide |
| SMILES | CC(C)(c1ccc(-c2cc(CNS(C)(=O)=O)on2)cc1)c1cc(Cl)c(OCCCCl)c(Cl)c1 |
| InChI | InChI=1S/C23H25Cl3N2O4S/c1-23(2,17-11-19(25)22(20(26)12-17)31-10-4-9-24)16-7-5-15(6-8-16)21-13-18(32-28-21)14-27-33(3,29)30/h5-8,11-13,27H,4,9-10,14H2,1-3H3 |
| InChIKey | MJLFHIOUURNZQT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.89 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|