C22H23Cl3N2O2 — CID 146484294
[3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenyl]-1,2-oxazol-5-yl]methanamine (PubChem CID 146484294) has the molecular formula C22H23Cl3N2O2 and a molecular weight of 453.80 g/mol. Its IUPAC name is [3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenyl]-1,2-oxazol-5-yl]methanamine.
| Compound Name | [3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenyl]-1,2-oxazol-5-yl]methanamine |
|---|---|
| PubChem CID | 146484294 |
| Molecular Formula | C22H23Cl3N2O2 |
| Molecular Weight | 453.80 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | [3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenyl]-1,2-oxazol-5-yl]methanamine |
| SMILES | CC(C)(c1ccc(-c2cc(CN)on2)cc1)c1cc(Cl)c(OCCCCl)c(Cl)c1 |
| InChI | InChI=1S/C22H23Cl3N2O2/c1-22(2,16-10-18(24)21(19(25)11-16)28-9-3-8-23)15-6-4-14(5-7-15)20-12-17(13-26)29-27-20/h4-7,10-12H,3,8-9,13,26H2,1-2H3 |
| InChIKey | GNMRLEFLRWCYPX-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.80 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|