C23H24Cl3NO5S — CID 146484330
5-[[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]methyl]-4-methylsulfonyl-1,3-oxazole (PubChem CID 146484330) has the molecular formula C23H24Cl3NO5S and a molecular weight of 532.87 g/mol. Its IUPAC name is 5-[[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]methyl]-4-methylsulfonyl-1,3-oxazole.
| Compound Name | 5-[[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]methyl]-4-methylsulfonyl-1,3-oxazole |
|---|---|
| PubChem CID | 146484330 |
| Molecular Formula | C23H24Cl3NO5S |
| Molecular Weight | 532.87 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | 5-[[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]methyl]-4-methylsulfonyl-1,3-oxazole |
| SMILES | CC(C)(c1ccc(OCc2ocnc2S(C)(=O)=O)cc1)c1cc(Cl)c(OCCCCl)c(Cl)c1 |
| InChI | InChI=1S/C23H24Cl3NO5S/c1-23(2,16-11-18(25)21(19(26)12-16)30-10-4-9-24)15-5-7-17(8-6-15)31-13-20-22(27-14-32-20)33(3,28)29/h5-8,11-12,14H,4,9-10,13H2,1-3H3 |
| InChIKey | VCAQVRVSFCIMOH-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.87 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|