C23H23Cl3N2O4 — CID 146485150
ethyl 2-[4-[(2R)-2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propyl]anilino]-1,3-oxazole-5-carboxylate (PubChem CID 146485150) has the molecular formula C23H23Cl3N2O4 and a molecular weight of 497.81 g/mol. Its IUPAC name is ethyl 2-[4-[(2R)-2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propyl]anilino]-1,3-oxazole-5-carboxylate.
| Compound Name | ethyl 2-[4-[(2R)-2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propyl]anilino]-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 146485150 |
| Molecular Formula | C23H23Cl3N2O4 |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | ethyl 2-[4-[(2R)-2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propyl]anilino]-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2ccc(C[C@@H](C)c3cc(Cl)c(OCCCl)c(Cl)c3)cc2)o1 |
| InChI | InChI=1S/C23H23Cl3N2O4/c1-3-30-22(29)20-13-27-23(32-20)28-17-6-4-15(5-7-17)10-14(2)16-11-18(25)21(19(26)12-16)31-9-8-24/h4-7,11-14H,3,8-10H2,1-2H3,(H,27,28)/t14-/m1/s1 |
| InChIKey | DSQSROHNGZNWRL-CQSZACIVSA-N |
| XLogP | 6.87 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|