C28H33FN4O2 — CID 146486194
3-[7-(3-aminopropyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal (PubChem CID 146486194) has the molecular formula C28H33FN4O2 and a molecular weight of 476.60 g/mol. Its IUPAC name is 3-[7-(3-aminopropyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal.
| Compound Name | 3-[7-(3-aminopropyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 146486194 |
| Molecular Formula | C28H33FN4O2 |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 3-[7-(3-aminopropyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)Cn1ncc2cc3c(cc21)c(CCCN)c(C1CCOCC1)n3-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H33FN4O2/c1-28(2,18-34)17-32-25-15-24-23(4-3-11-30)27(19-9-12-35-13-10-19)33(22-7-5-21(29)6-8-22)26(24)14-20(25)16-31-32/h5-8,14-16,18-19H,3-4,9-13,17,30H2,1-2H3 |
| InChIKey | MVHIALKGEXIVKM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|