C31H37FN4O2 — CID 146486198
3-[5-(4-fluorophenyl)-6-(oxan-4-yl)-7-[[(3R)-piperidin-3-yl]methyl]pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal (PubChem CID 146486198) has the molecular formula C31H37FN4O2 and a molecular weight of 516.66 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-6-(oxan-4-yl)-7-[[(3R)-piperidin-3-yl]methyl]pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal.
| Compound Name | 3-[5-(4-fluorophenyl)-6-(oxan-4-yl)-7-[[(3R)-piperidin-3-yl]methyl]pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 146486198 |
| Molecular Formula | C31H37FN4O2 |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-6-(oxan-4-yl)-7-[[(3R)-piperidin-3-yl]methyl]pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)Cn1ncc2cc3c(cc21)c(C[C@H]1CCCNC1)c(C1CCOCC1)n3-c1ccc(F)cc1 |
| InChI | InChI=1S/C31H37FN4O2/c1-31(2,20-37)19-35-28-16-26-27(14-21-4-3-11-33-17-21)30(22-9-12-38-13-10-22)36(25-7-5-24(32)6-8-25)29(26)15-23(28)18-34-35/h5-8,15-16,18,20-22,33H,3-4,9-14,17,19H2,1-2H3/t21-/m1/s1 |
| InChIKey | DZTSNTFNILVDHU-OAQYLSRUSA-N |
| XLogP | 5.78 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|