C29H32FN3O4S — CID 146486199
3-[7-[(E)-2-ethylsulfonylethenyl]-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal (PubChem CID 146486199) has the molecular formula C29H32FN3O4S and a molecular weight of 537.66 g/mol. Its IUPAC name is 3-[7-[(E)-2-ethylsulfonylethenyl]-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal.
| Compound Name | 3-[7-[(E)-2-ethylsulfonylethenyl]-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 146486199 |
| Molecular Formula | C29H32FN3O4S |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 3-[7-[(E)-2-ethylsulfonylethenyl]-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal |
| SMILES | CCS(=O)(=O)/C=C/c1c(C2CCOCC2)n(-c2ccc(F)cc2)c2cc3cnn(CC(C)(C)C=O)c3cc12 |
| InChI | InChI=1S/C29H32FN3O4S/c1-4-38(35,36)14-11-24-25-16-26-21(17-31-32(26)18-29(2,3)19-34)15-27(25)33(23-7-5-22(30)6-8-23)28(24)20-9-12-37-13-10-20/h5-8,11,14-17,19-20H,4,9-10,12-13,18H2,1-3H3/b14-11+ |
| InChIKey | WJDWYJULSRNRNH-SDNWHVSQSA-N |
| XLogP | 5.64 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|