C25H25FIN3O2 — CID 146486200
3-[5-(4-fluorophenyl)-7-iodo-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal (PubChem CID 146486200) has the molecular formula C25H25FIN3O2 and a molecular weight of 545.40 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-7-iodo-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal.
| Compound Name | 3-[5-(4-fluorophenyl)-7-iodo-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 146486200 |
| Molecular Formula | C25H25FIN3O2 |
| Molecular Weight | 545.40 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-7-iodo-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)Cn1ncc2cc3c(cc21)c(I)c(C1CCOCC1)n3-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H25FIN3O2/c1-25(2,15-31)14-29-21-12-20-22(11-17(21)13-28-29)30(19-5-3-18(26)4-6-19)24(23(20)27)16-7-9-32-10-8-16/h3-6,11-13,15-16H,7-10,14H2,1-2H3 |
| InChIKey | NENSCAHZTQJIMS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.40 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|