About 8-fluoro-5-(4-fluoro-3-methylphenyl)-2-(oxan-2-yl)-6-propan-2-ylpyrrolo[2,3-f]indazole
8-fluoro-5-(4-fluoro-3-methylphenyl)-2-(oxan-2-yl)-6-propan-2-ylpyrrolo[2,3-f]indazole (PubChem CID 146486247) has the molecular formula C24H25F2N3O
and a molecular weight of 409.48 g/mol. Its IUPAC name is 8-fluoro-5-(4-fluoro-3-methylphenyl)-2-(oxan-2-yl)-6-propan-2-ylpyrrolo[2,3-f]indazole.
Molecular Properties
| Compound Name | 8-fluoro-5-(4-fluoro-3-methylphenyl)-2-(oxan-2-yl)-6-propan-2-ylpyrrolo[2,3-f]indazole |
| PubChem CID | 146486247 |
| Molecular Formula | C24H25F2N3O |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 8-fluoro-5-(4-fluoro-3-methylphenyl)-2-(oxan-2-yl)-6-propan-2-ylpyrrolo[2,3-f]indazole |
| SMILES | Cc1cc(-n2c(C(C)C)cc3c(F)c4nn(C5CCCCO5)cc4cc32)ccc1F |
| InChI | InChI=1S/C24H25F2N3O/c1-14(2)20-12-18-21(29(20)17-7-8-19(25)15(3)10-17)11-16-13-28(27-24(16)23(18)26)22-6-4-5-9-30-22/h7-8,10-14,22H,4-6,9H2,1-3H3 |
| InChIKey | AJDCHCYIEZEYJY-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-fluoro-5-(4-fluoro-3-methylphenyl)-2-(oxan-2-yl)-6-propan-2-ylpyrrolo[2,3-f]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-5-(4-fluoro-3-methylphenyl)-2-(oxan-2-yl)-6-propan-2-ylpyrrolo[2,3-f]indazole?
The IUPAC name of 8-fluoro-5-(4-fluoro-3-methylphenyl)-2-(oxan-2-yl)-6-propan-2-ylpyrrolo[2,3-f]indazole (CID 146486247) is 8-fluoro-5-(4-fluoro-3-methylphenyl)-2-(oxan-2-yl)-6-propan-2-ylpyrrolo[2,3-f]indazole.
What is the SMILES notation for 8-fluoro-5-(4-fluoro-3-methylphenyl)-2-(oxan-2-yl)-6-propan-2-ylpyrrolo[2,3-f]indazole?
The canonical SMILES for 8-fluoro-5-(4-fluoro-3-methylphenyl)-2-(oxan-2-yl)-6-propan-2-ylpyrrolo[2,3-f]indazole is Cc1cc(-n2c(C(C)C)cc3c(F)c4nn(C5CCCCO5)cc4cc32)ccc1F.
What is the InChIKey of 8-fluoro-5-(4-fluoro-3-methylphenyl)-2-(oxan-2-yl)-6-propan-2-ylpyrrolo[2,3-f]indazole?
The InChIKey is AJDCHCYIEZEYJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25F2N3O/c1-14(2)20-12-18-21(29(20)17-7-8-19(25)15(3)10-17)11-16-13-28(27-24(16)23(18)26)22-6-4-5-9-30-22/h7-8,10-14,22H,4-6,9H2,1-3H3.
What are the key properties of 8-fluoro-5-(4-fluoro-3-methylphenyl)-2-(oxan-2-yl)-6-propan-2-ylpyrrolo[2,3-f]indazole?
8-fluoro-5-(4-fluoro-3-methylphenyl)-2-(oxan-2-yl)-6-propan-2-ylpyrrolo[2,3-f]indazole has a molecular weight of 409.48 g/mol, XLogP of 6.39, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-5-(4-fluoro-3-methylphenyl)-2-(oxan-2-yl)-6-propan-2-ylpyrrolo[2,3-f]indazole is sourced from PubChem (CID 146486247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).