C28H23FN2O4S — CID 146486277
(E)-3-[5-(benzenesulfonyl)-1-(4-fluorophenyl)-2-propan-2-ylpyrrolo[2,3-f]indol-3-yl]prop-2-enoic acid (PubChem CID 146486277) has the molecular formula C28H23FN2O4S and a molecular weight of 502.57 g/mol. Its IUPAC name is (E)-3-[5-(benzenesulfonyl)-1-(4-fluorophenyl)-2-propan-2-ylpyrrolo[2,3-f]indol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(benzenesulfonyl)-1-(4-fluorophenyl)-2-propan-2-ylpyrrolo[2,3-f]indol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 146486277 |
| Molecular Formula | C28H23FN2O4S |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | (E)-3-[5-(benzenesulfonyl)-1-(4-fluorophenyl)-2-propan-2-ylpyrrolo[2,3-f]indol-3-yl]prop-2-enoic acid |
| SMILES | CC(C)c1c(/C=C/C(=O)O)c2cc3c(ccn3S(=O)(=O)c3ccccc3)cc2n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H23FN2O4S/c1-18(2)28-23(12-13-27(32)33)24-17-25-19(16-26(24)31(28)21-10-8-20(29)9-11-21)14-15-30(25)36(34,35)22-6-4-3-5-7-22/h3-18H,1-2H3,(H,32,33)/b13-12+ |
| InChIKey | XTOPRIVEXINRCQ-OUKQBFOZSA-N |
| XLogP | 6.18 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|