About 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(piperidin-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole
5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(piperidin-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole (PubChem CID 146486310) has the molecular formula C26H29FN4O
and a molecular weight of 432.54 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(piperidin-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(piperidin-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole |
| PubChem CID | 146486310 |
| Molecular Formula | C26H29FN4O |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(piperidin-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole |
| SMILES | Fc1ccc(-n2c(C3CCOCC3)c(CC3CCNCC3)c3cc4[nH]ncc4cc32)cc1 |
| InChI | InChI=1S/C26H29FN4O/c27-20-1-3-21(4-2-20)31-25-14-19-16-29-30-24(19)15-22(25)23(13-17-5-9-28-10-6-17)26(31)18-7-11-32-12-8-18/h1-4,14-18,28H,5-13H2,(H,29,30) |
| InChIKey | ADKYSUAHQBSKMN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(piperidin-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(piperidin-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole?
The IUPAC name of 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(piperidin-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole (CID 146486310) is 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(piperidin-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole.
What is the SMILES notation for 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(piperidin-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole?
The canonical SMILES for 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(piperidin-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole is Fc1ccc(-n2c(C3CCOCC3)c(CC3CCNCC3)c3cc4[nH]ncc4cc32)cc1.
What is the InChIKey of 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(piperidin-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole?
The InChIKey is ADKYSUAHQBSKMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29FN4O/c27-20-1-3-21(4-2-20)31-25-14-19-16-29-30-24(19)15-22(25)23(13-17-5-9-28-10-6-17)26(31)18-7-11-32-12-8-18/h1-4,14-18,28H,5-13H2,(H,29,30).
What are the key properties of 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(piperidin-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole?
5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(piperidin-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole has a molecular weight of 432.54 g/mol, XLogP of 5.08, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(piperidin-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole is sourced from PubChem (CID 146486310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).