C36H39FN4O4 — CID 146486353
benzyl N-[3-[1-(2,2-dimethylpropanoyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-7-yl]propyl]carbamate (PubChem CID 146486353) has the molecular formula C36H39FN4O4 and a molecular weight of 610.73 g/mol. Its IUPAC name is benzyl N-[3-[1-(2,2-dimethylpropanoyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-7-yl]propyl]carbamate.
| Compound Name | benzyl N-[3-[1-(2,2-dimethylpropanoyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-7-yl]propyl]carbamate |
|---|---|
| PubChem CID | 146486353 |
| Molecular Formula | C36H39FN4O4 |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | benzyl N-[3-[1-(2,2-dimethylpropanoyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-7-yl]propyl]carbamate |
| SMILES | CC(C)(C)C(=O)n1ncc2cc3c(cc21)c(CCCNC(=O)OCc1ccccc1)c(C1CCOCC1)n3-c1ccc(F)cc1 |
| InChI | InChI=1S/C36H39FN4O4/c1-36(2,3)34(42)41-31-21-30-29(10-7-17-38-35(43)45-23-24-8-5-4-6-9-24)33(25-15-18-44-19-16-25)40(28-13-11-27(37)12-14-28)32(30)20-26(31)22-39-41/h4-6,8-9,11-14,20-22,25H,7,10,15-19,23H2,1-3H3,(H,38,43) |
| InChIKey | YKFRWFIXSYUPDF-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|