About tert-butyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate
tert-butyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate (PubChem CID 146486401) has the molecular formula C27H22F2N4O3
and a molecular weight of 488.49 g/mol. Its IUPAC name is tert-butyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate.
Molecular Properties
| Compound Name | tert-butyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate |
| PubChem CID | 146486401 |
| Molecular Formula | C27H22F2N4O3 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | tert-butyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-c2ccc(F)c(F)c2)cc1N1Cc2ccc(-c3cn[nH]n3)cc2C1=O |
| InChI | InChI=1S/C27H22F2N4O3/c1-27(2,3)36-26(35)19-8-6-16(15-7-9-21(28)22(29)11-15)12-24(19)33-14-18-5-4-17(10-20(18)25(33)34)23-13-30-32-31-23/h4-13H,14H2,1-3H3,(H,30,31,32) |
| InChIKey | QTLVDJMURVQZTH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate?
The IUPAC name of tert-butyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate (CID 146486401) is tert-butyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate.
What is the SMILES notation for tert-butyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate?
The canonical SMILES for tert-butyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate is CC(C)(C)OC(=O)c1ccc(-c2ccc(F)c(F)c2)cc1N1Cc2ccc(-c3cn[nH]n3)cc2C1=O.
What is the InChIKey of tert-butyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate?
The InChIKey is QTLVDJMURVQZTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22F2N4O3/c1-27(2,3)36-26(35)19-8-6-16(15-7-9-21(28)22(29)11-15)12-24(19)33-14-18-5-4-17(10-20(18)25(33)34)23-13-30-32-31-23/h4-13H,14H2,1-3H3,(H,30,31,32).
What are the key properties of tert-butyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate?
tert-butyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate has a molecular weight of 488.49 g/mol, XLogP of 5.53, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate is sourced from PubChem (CID 146486401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).