About 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoic acid
4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoic acid (PubChem CID 146486421) has the molecular formula C23H14F2N4O3
and a molecular weight of 432.39 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoic acid |
| PubChem CID | 146486421 |
| Molecular Formula | C23H14F2N4O3 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(F)c(F)c2)cc1N1Cc2ccc(-c3cn[nH]n3)cc2C1=O |
| InChI | InChI=1S/C23H14F2N4O3/c24-18-6-4-12(8-19(18)25)13-3-5-16(23(31)32)21(9-13)29-11-15-2-1-14(7-17(15)22(29)30)20-10-26-28-27-20/h1-10H,11H2,(H,31,32)(H,26,27,28) |
| InChIKey | SOSNVBZZNFKGBM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoic acid?
The IUPAC name of 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoic acid (CID 146486421) is 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoic acid.
What is the SMILES notation for 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoic acid?
The canonical SMILES for 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoic acid is O=C(O)c1ccc(-c2ccc(F)c(F)c2)cc1N1Cc2ccc(-c3cn[nH]n3)cc2C1=O.
What is the InChIKey of 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoic acid?
The InChIKey is SOSNVBZZNFKGBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14F2N4O3/c24-18-6-4-12(8-19(18)25)13-3-5-16(23(31)32)21(9-13)29-11-15-2-1-14(7-17(15)22(29)30)20-10-26-28-27-20/h1-10H,11H2,(H,31,32)(H,26,27,28).
What are the key properties of 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoic acid?
4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoic acid has a molecular weight of 432.39 g/mol, XLogP of 4.28, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoic acid is sourced from PubChem (CID 146486421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).