About 2-[[2-carboxy-5-(3,4-difluorophenyl)benzoyl]amino]-5-chloro-4-(2H-triazol-4-yl)benzoic acid
2-[[2-carboxy-5-(3,4-difluorophenyl)benzoyl]amino]-5-chloro-4-(2H-triazol-4-yl)benzoic acid (PubChem CID 146486428) has the molecular formula C23H13ClF2N4O5
and a molecular weight of 498.83 g/mol. Its IUPAC name is 2-[[2-carboxy-5-(3,4-difluorophenyl)benzoyl]amino]-5-chloro-4-(2H-triazol-4-yl)benzoic acid.
Molecular Properties
| Compound Name | 2-[[2-carboxy-5-(3,4-difluorophenyl)benzoyl]amino]-5-chloro-4-(2H-triazol-4-yl)benzoic acid |
| PubChem CID | 146486428 |
| Molecular Formula | C23H13ClF2N4O5 |
| Molecular Weight | 498.83 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | 2-[[2-carboxy-5-(3,4-difluorophenyl)benzoyl]amino]-5-chloro-4-(2H-triazol-4-yl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(-c2cn[nH]n2)cc1NC(=O)c1cc(-c2ccc(F)c(F)c2)ccc1C(=O)O |
| InChI | InChI=1S/C23H13ClF2N4O5/c24-16-7-15(23(34)35)19(8-14(16)20-9-27-30-29-20)28-21(31)13-5-10(1-3-12(13)22(32)33)11-2-4-17(25)18(26)6-11/h1-9H,(H,28,31)(H,32,33)(H,34,35)(H,27,29,30) |
| InChIKey | SDDZNHJGEHBFGP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.83 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-carboxy-5-(3,4-difluorophenyl)benzoyl]amino]-5-chloro-4-(2H-triazol-4-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-carboxy-5-(3,4-difluorophenyl)benzoyl]amino]-5-chloro-4-(2H-triazol-4-yl)benzoic acid?
The IUPAC name of 2-[[2-carboxy-5-(3,4-difluorophenyl)benzoyl]amino]-5-chloro-4-(2H-triazol-4-yl)benzoic acid (CID 146486428) is 2-[[2-carboxy-5-(3,4-difluorophenyl)benzoyl]amino]-5-chloro-4-(2H-triazol-4-yl)benzoic acid.
What is the SMILES notation for 2-[[2-carboxy-5-(3,4-difluorophenyl)benzoyl]amino]-5-chloro-4-(2H-triazol-4-yl)benzoic acid?
The canonical SMILES for 2-[[2-carboxy-5-(3,4-difluorophenyl)benzoyl]amino]-5-chloro-4-(2H-triazol-4-yl)benzoic acid is O=C(O)c1cc(Cl)c(-c2cn[nH]n2)cc1NC(=O)c1cc(-c2ccc(F)c(F)c2)ccc1C(=O)O.
What is the InChIKey of 2-[[2-carboxy-5-(3,4-difluorophenyl)benzoyl]amino]-5-chloro-4-(2H-triazol-4-yl)benzoic acid?
The InChIKey is SDDZNHJGEHBFGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13ClF2N4O5/c24-16-7-15(23(34)35)19(8-14(16)20-9-27-30-29-20)28-21(31)13-5-10(1-3-12(13)22(32)33)11-2-4-17(25)18(26)6-11/h1-9H,(H,28,31)(H,32,33)(H,34,35)(H,27,29,30).
What are the key properties of 2-[[2-carboxy-5-(3,4-difluorophenyl)benzoyl]amino]-5-chloro-4-(2H-triazol-4-yl)benzoic acid?
2-[[2-carboxy-5-(3,4-difluorophenyl)benzoyl]amino]-5-chloro-4-(2H-triazol-4-yl)benzoic acid has a molecular weight of 498.83 g/mol, XLogP of 4.72, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-carboxy-5-(3,4-difluorophenyl)benzoyl]amino]-5-chloro-4-(2H-triazol-4-yl)benzoic acid is sourced from PubChem (CID 146486428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).