About methyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate
methyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate (PubChem CID 146486517) has the molecular formula C24H16F2N4O3
and a molecular weight of 446.41 g/mol. Its IUPAC name is methyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate |
| PubChem CID | 146486517 |
| Molecular Formula | C24H16F2N4O3 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | methyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(F)c(F)c2)cc1N1Cc2ccc(-c3cn[nH]n3)cc2C1=O |
| InChI | InChI=1S/C24H16F2N4O3/c1-33-24(32)17-6-4-14(13-5-7-19(25)20(26)9-13)10-22(17)30-12-16-3-2-15(8-18(16)23(30)31)21-11-27-29-28-21/h2-11H,12H2,1H3,(H,27,28,29) |
| InChIKey | VFVUMEHWEWMOHY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate?
The IUPAC name of methyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate (CID 146486517) is methyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate.
What is the SMILES notation for methyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate?
The canonical SMILES for methyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate is COC(=O)c1ccc(-c2ccc(F)c(F)c2)cc1N1Cc2ccc(-c3cn[nH]n3)cc2C1=O.
What is the InChIKey of methyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate?
The InChIKey is VFVUMEHWEWMOHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16F2N4O3/c1-33-24(32)17-6-4-14(13-5-7-19(25)20(26)9-13)10-22(17)30-12-16-3-2-15(8-18(16)23(30)31)21-11-27-29-28-21/h2-11H,12H2,1H3,(H,27,28,29).
What are the key properties of methyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate?
methyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate has a molecular weight of 446.41 g/mol, XLogP of 4.36, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3,4-difluorophenyl)-2-[3-oxo-5-(2H-triazol-4-yl)-1H-isoindol-2-yl]benzoate is sourced from PubChem (CID 146486517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).