C19H14F5NO2 — CID 146486889
3-(4-ethyl-1,1,2,2-tetrafluoro-3-hydroxy-3-methylinden-5-yl)oxy-5-fluorobenzonitrile (PubChem CID 146486889) has the molecular formula C19H14F5NO2 and a molecular weight of 383.32 g/mol. Its IUPAC name is 3-(4-ethyl-1,1,2,2-tetrafluoro-3-hydroxy-3-methylinden-5-yl)oxy-5-fluorobenzonitrile.
| Compound Name | 3-(4-ethyl-1,1,2,2-tetrafluoro-3-hydroxy-3-methylinden-5-yl)oxy-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 146486889 |
| Molecular Formula | C19H14F5NO2 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 3-(4-ethyl-1,1,2,2-tetrafluoro-3-hydroxy-3-methylinden-5-yl)oxy-5-fluorobenzonitrile |
| SMILES | CCc1c(Oc2cc(F)cc(C#N)c2)ccc2c1C(C)(O)C(F)(F)C2(F)F |
| InChI | InChI=1S/C19H14F5NO2/c1-3-13-15(27-12-7-10(9-25)6-11(20)8-12)5-4-14-16(13)17(2,26)19(23,24)18(14,21)22/h4-8,26H,3H2,1-2H3 |
| InChIKey | HJWSVBADJZVPQV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|