C15H6F7NO2 — CID 146486942
7-(difluoromethyl)-2,2,3,3-tetrafluoro-6-[(5-fluoro-3-pyridinyl)oxy]inden-1-one (PubChem CID 146486942) has the molecular formula C15H6F7NO2 and a molecular weight of 365.20 g/mol. Its IUPAC name is 7-(difluoromethyl)-2,2,3,3-tetrafluoro-6-[(5-fluoro-3-pyridinyl)oxy]inden-1-one.
| Compound Name | 7-(difluoromethyl)-2,2,3,3-tetrafluoro-6-[(5-fluoro-3-pyridinyl)oxy]inden-1-one |
|---|---|
| PubChem CID | 146486942 |
| Molecular Formula | C15H6F7NO2 |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 7-(difluoromethyl)-2,2,3,3-tetrafluoro-6-[(5-fluoro-3-pyridinyl)oxy]inden-1-one |
| SMILES | O=C1c2c(ccc(Oc3cncc(F)c3)c2C(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C15H6F7NO2/c16-6-3-7(5-23-4-6)25-9-2-1-8-10(11(9)13(17)18)12(24)15(21,22)14(8,19)20/h1-5,13H |
| InChIKey | LKLSNKOWQIXIQG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|