C24H15F3N4O — CID 146487139
7-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-6-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine (PubChem CID 146487139) has the molecular formula C24H15F3N4O and a molecular weight of 432.41 g/mol. Its IUPAC name is 7-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-6-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine.
| Compound Name | 7-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-6-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 146487139 |
| Molecular Formula | C24H15F3N4O |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 7-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-6-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine |
| SMILES | Cc1ccc2c(Nc3cccc(C(F)(F)F)c3)noc2c1C#Cc1cnc2ccccn12 |
| InChI | InChI=1S/C24H15F3N4O/c1-15-8-10-20-22(19(15)11-9-18-14-28-21-7-2-3-12-31(18)21)32-30-23(20)29-17-6-4-5-16(13-17)24(25,26)27/h2-8,10,12-14H,1H3,(H,29,30) |
| InChIKey | AVXKGPWUWFTWEQ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 55.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|