C26H25ClN4O2 — CID 146487687
4-[[4-(2-chloro-4-pyridinyl)phenyl]methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]pyrrolo[1,2-b]pyridazine-2-carboxamide (PubChem CID 146487687) has the molecular formula C26H25ClN4O2 and a molecular weight of 460.97 g/mol. Its IUPAC name is 4-[[4-(2-chloro-4-pyridinyl)phenyl]methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]pyrrolo[1,2-b]pyridazine-2-carboxamide.
| Compound Name | 4-[[4-(2-chloro-4-pyridinyl)phenyl]methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]pyrrolo[1,2-b]pyridazine-2-carboxamide |
|---|---|
| PubChem CID | 146487687 |
| Molecular Formula | C26H25ClN4O2 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 4-[[4-(2-chloro-4-pyridinyl)phenyl]methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]pyrrolo[1,2-b]pyridazine-2-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1O)c1cc(Cc2ccc(-c3ccnc(Cl)c3)cc2)c2cccn2n1 |
| InChI | InChI=1S/C26H25ClN4O2/c27-25-16-19(11-12-28-25)18-9-7-17(8-10-18)14-20-15-22(30-31-13-3-5-23(20)31)26(33)29-21-4-1-2-6-24(21)32/h3,5,7-13,15-16,21,24,32H,1-2,4,6,14H2,(H,29,33)/t21-,24-/m0/s1 |
| InChIKey | AXSQBLCJZCBFAX-URXFXBBRSA-N |
| XLogP | 4.67 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|