C28H33N3O4 — CID 146487736
6-(2,3-dihydro-1H-inden-2-yloxy)-1-ethyl-3-(2,2,6,6-tetramethylmorpholine-4-carbonyl)-1,8-naphthyridin-4-one (PubChem CID 146487736) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is 6-(2,3-dihydro-1H-inden-2-yloxy)-1-ethyl-3-(2,2,6,6-tetramethylmorpholine-4-carbonyl)-1,8-naphthyridin-4-one.
| Compound Name | 6-(2,3-dihydro-1H-inden-2-yloxy)-1-ethyl-3-(2,2,6,6-tetramethylmorpholine-4-carbonyl)-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 146487736 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 6-(2,3-dihydro-1H-inden-2-yloxy)-1-ethyl-3-(2,2,6,6-tetramethylmorpholine-4-carbonyl)-1,8-naphthyridin-4-one |
| SMILES | CCn1cc(C(=O)N2CC(C)(C)OC(C)(C)C2)c(=O)c2cc(OC3Cc4ccccc4C3)cnc21 |
| InChI | InChI=1S/C28H33N3O4/c1-6-30-15-23(26(33)31-16-27(2,3)35-28(4,5)17-31)24(32)22-13-21(14-29-25(22)30)34-20-11-18-9-7-8-10-19(18)12-20/h7-10,13-15,20H,6,11-12,16-17H2,1-5H3 |
| InChIKey | LFMWVYHFISFHLG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |