C18H26N6O2 — CID 146487911
1-N,4-N-bis[2-(1H-imidazol-5-yl)ethyl]cyclohexane-1,4-dicarboxamide (PubChem CID 146487911) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 1-N,4-N-bis[2-(1H-imidazol-5-yl)ethyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[2-(1H-imidazol-5-yl)ethyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 146487911 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1-N,4-N-bis[2-(1H-imidazol-5-yl)ethyl]cyclohexane-1,4-dicarboxamide |
| SMILES | O=C(NCCc1cnc[nH]1)C1CCC(C(=O)NCCc2cnc[nH]2)CC1 |
| InChI | InChI=1S/C18H26N6O2/c25-17(21-7-5-15-9-19-11-23-15)13-1-2-14(4-3-13)18(26)22-8-6-16-10-20-12-24-16/h9-14H,1-8H2,(H,19,23)(H,20,24)(H,21,25)(H,22,26) |
| InChIKey | RADOCAUSDIAXKS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |