C26H29FN6O3 — CID 146488801
[(1R,5S)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl] N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate (PubChem CID 146488801) has the molecular formula C26H29FN6O3 and a molecular weight of 492.56 g/mol. Its IUPAC name is [(1R,5S)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl] N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate.
| Compound Name | [(1R,5S)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl] N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 146488801 |
| Molecular Formula | C26H29FN6O3 |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | [(1R,5S)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl] N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate |
| SMILES | Cc1c(-c2cc3cc(NC(=O)OC4[C@H]5CN(C(C)C)C[C@@H]45)ncc3c(N)c2F)cnc2c1NCCO2 |
| InChI | InChI=1S/C26H29FN6O3/c1-12(2)33-10-18-19(11-33)24(18)36-26(34)32-20-7-14-6-15(21(27)22(28)17(14)9-30-20)16-8-31-25-23(13(16)3)29-4-5-35-25/h6-9,12,18-19,24,29H,4-5,10-11,28H2,1-3H3,(H,30,32,34)/t18-,19+,24? |
| InChIKey | HRYHHHGQBAHHSJ-QRQCMCJISA-N |
| XLogP | 4.02 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|