C26H27FN6O4 — CID 146488804
[(1S,5R)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl] N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate (PubChem CID 146488804) has the molecular formula C26H27FN6O4 and a molecular weight of 506.54 g/mol. Its IUPAC name is [(1S,5R)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl] N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate.
| Compound Name | [(1S,5R)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl] N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 146488804 |
| Molecular Formula | C26H27FN6O4 |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [(1S,5R)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl] N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate |
| SMILES | Cc1c(-c2cc3cc(NC(=O)OC4[C@H]5CN(C6COC6)C[C@@H]45)ncc3c(N)c2F)cnc2c1NCCO2 |
| InChI | InChI=1S/C26H27FN6O4/c1-12-16(6-31-25-23(12)29-2-3-36-25)15-4-13-5-20(30-7-17(13)22(28)21(15)27)32-26(34)37-24-18-8-33(9-19(18)24)14-10-35-11-14/h4-7,14,18-19,24,29H,2-3,8-11,28H2,1H3,(H,30,32,34)/t18-,19+,24? |
| InChIKey | GWNGKWGUQLGNGK-QRQCMCJISA-N |
| XLogP | 3.01 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|