C7H8F5N3 — CID 146489205
(Z)-4,4,5,5,5-pentafluoro-N'-methyl-3-(methylideneamino)pent-2-enimidamide (PubChem CID 146489205) has the molecular formula C7H8F5N3 and a molecular weight of 229.15 g/mol. Its IUPAC name is (Z)-4,4,5,5,5-pentafluoro-N'-methyl-3-(methylideneamino)pent-2-enimidamide.
| Compound Name | (Z)-4,4,5,5,5-pentafluoro-N'-methyl-3-(methylideneamino)pent-2-enimidamide |
|---|---|
| PubChem CID | 146489205 |
| Molecular Formula | C7H8F5N3 |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | (Z)-4,4,5,5,5-pentafluoro-N'-methyl-3-(methylideneamino)pent-2-enimidamide |
| SMILES | C=N/C(=C\C(N)=N\C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8F5N3/c1-14-4(3-5(13)15-2)6(8,9)7(10,11)12/h3H,1H2,2H3,(H2,13,15)/b4-3- |
| InChIKey | FTYOQUOUSCJJGP-ARJAWSKDSA-N |
| XLogP | 1.76 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|