C15H23NO — CID 146489352
(Z,2Z,3E)-3-(methoxymethylidene)-4-methylidene-2-prop-2-enylidenenon-7-en-1-amine (PubChem CID 146489352) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is (Z,2Z,3E)-3-(methoxymethylidene)-4-methylidene-2-prop-2-enylidenenon-7-en-1-amine.
| Compound Name | (Z,2Z,3E)-3-(methoxymethylidene)-4-methylidene-2-prop-2-enylidenenon-7-en-1-amine |
|---|---|
| PubChem CID | 146489352 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (Z,2Z,3E)-3-(methoxymethylidene)-4-methylidene-2-prop-2-enylidenenon-7-en-1-amine |
| SMILES | C=C/C=C(CN)/C(=C/OC)C(=C)CC/C=C\C |
| InChI | InChI=1S/C15H23NO/c1-5-7-8-10-13(3)15(12-17-4)14(11-16)9-6-2/h5-7,9,12H,2-3,8,10-11,16H2,1,4H3/b7-5-,14-9+,15-12+ |
| InChIKey | PFQPSIMWBOWFJL-NVLAFLFVSA-N |
| XLogP | 3.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|