About N-[2-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-yl]formamide
N-[2-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-yl]formamide (PubChem CID 146490022) has the molecular formula C14H12F2N4OS
and a molecular weight of 322.34 g/mol. Its IUPAC name is N-[2-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-yl]formamide.
Molecular Properties
| Compound Name | N-[2-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-yl]formamide |
| PubChem CID | 146490022 |
| Molecular Formula | C14H12F2N4OS |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | N-[2-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-yl]formamide |
| SMILES | O=CNc1csc(-c2ccc(N3CC4C(C3)C4(F)F)nc2)n1 |
| InChI | InChI=1S/C14H12F2N4OS/c15-14(16)9-4-20(5-10(9)14)12-2-1-8(3-17-12)13-19-11(6-22-13)18-7-21/h1-3,6-7,9-10H,4-5H2,(H,18,21) |
| InChIKey | LYADKZZKBMIHAH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-yl]formamide?
The IUPAC name of N-[2-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-yl]formamide (CID 146490022) is N-[2-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-yl]formamide.
What is the SMILES notation for N-[2-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-yl]formamide?
The canonical SMILES for N-[2-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-yl]formamide is O=CNc1csc(-c2ccc(N3CC4C(C3)C4(F)F)nc2)n1.
What is the InChIKey of N-[2-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-yl]formamide?
The InChIKey is LYADKZZKBMIHAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2N4OS/c15-14(16)9-4-20(5-10(9)14)12-2-1-8(3-17-12)13-19-11(6-22-13)18-7-21/h1-3,6-7,9-10H,4-5H2,(H,18,21).
What are the key properties of N-[2-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-yl]formamide?
N-[2-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-yl]formamide has a molecular weight of 322.34 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-yl]formamide is sourced from PubChem (CID 146490022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).