C24H19F2N7O — CID 146490612
8-(2-cyclopropyl-6-methyl-4-pyridinyl)-2-[(2,6-difluorophenyl)methyl]-7-(1,3-oxazol-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine (PubChem CID 146490612) has the molecular formula C24H19F2N7O and a molecular weight of 459.46 g/mol. Its IUPAC name is 8-(2-cyclopropyl-6-methyl-4-pyridinyl)-2-[(2,6-difluorophenyl)methyl]-7-(1,3-oxazol-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | 8-(2-cyclopropyl-6-methyl-4-pyridinyl)-2-[(2,6-difluorophenyl)methyl]-7-(1,3-oxazol-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 146490612 |
| Molecular Formula | C24H19F2N7O |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 8-(2-cyclopropyl-6-methyl-4-pyridinyl)-2-[(2,6-difluorophenyl)methyl]-7-(1,3-oxazol-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
| SMILES | Cc1cc(-c2c(-c3ncco3)nc(N)n3nc(Cc4c(F)cccc4F)nc23)cc(C2CC2)n1 |
| InChI | InChI=1S/C24H19F2N7O/c1-12-9-14(10-18(29-12)13-5-6-13)20-21(23-28-7-8-34-23)31-24(27)33-22(20)30-19(32-33)11-15-16(25)3-2-4-17(15)26/h2-4,7-10,13H,5-6,11H2,1H3,(H2,27,31) |
| InChIKey | IGVXFKNQGUZYLD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |