About 5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one
5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one (PubChem CID 14649072) has the molecular formula C17H26N2OS
and a molecular weight of 306.47 g/mol. Its IUPAC name is 5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one |
| PubChem CID | 14649072 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCCCC1SC(c2cccnc2)NC1=O |
| InChI | InChI=1S/C17H26N2OS/c1-2-3-4-5-6-7-8-11-15-16(20)19-17(21-15)14-10-9-12-18-13-14/h9-10,12-13,15,17H,2-8,11H2,1H3,(H,19,20) |
| InChIKey | FHYIJCJUQUFAES-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one?
The IUPAC name of 5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one (CID 14649072) is 5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one.
What is the SMILES notation for 5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one?
The canonical SMILES for 5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one is CCCCCCCCCC1SC(c2cccnc2)NC1=O.
What is the InChIKey of 5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one?
The InChIKey is FHYIJCJUQUFAES-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2OS/c1-2-3-4-5-6-7-8-11-15-16(20)19-17(21-15)14-10-9-12-18-13-14/h9-10,12-13,15,17H,2-8,11H2,1H3,(H,19,20).
What are the key properties of 5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one?
5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one has a molecular weight of 306.47 g/mol, XLogP of 4.45, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one is sourced from PubChem (CID 14649072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).