C10H12N2OS — CID 14649075
(2R,5R)-3,5-dimethyl-2-pyridin-3-yl-1,3-thiazolidin-4-one (PubChem CID 14649075) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is (2R,5R)-3,5-dimethyl-2-pyridin-3-yl-1,3-thiazolidin-4-one.
| Compound Name | (2R,5R)-3,5-dimethyl-2-pyridin-3-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 14649075 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (2R,5R)-3,5-dimethyl-2-pyridin-3-yl-1,3-thiazolidin-4-one |
| SMILES | C[C@H]1S[C@H](c2cccnc2)N(C)C1=O |
| InChI | InChI=1S/C10H12N2OS/c1-7-9(13)12(2)10(14-7)8-4-3-5-11-6-8/h3-7,10H,1-2H3/t7-,10-/m1/s1 |
| InChIKey | FZXAQGVGSAANBR-GMSGAONNSA-N |
| XLogP | 1.67 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |