C21H16F2N8O — CID 146490904
8-(2-amino-6-methyl-4-pyridinyl)-2-[(2,6-difluorophenyl)methyl]-7-(1,3-oxazol-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine (PubChem CID 146490904) has the molecular formula C21H16F2N8O and a molecular weight of 434.41 g/mol. Its IUPAC name is 8-(2-amino-6-methyl-4-pyridinyl)-2-[(2,6-difluorophenyl)methyl]-7-(1,3-oxazol-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | 8-(2-amino-6-methyl-4-pyridinyl)-2-[(2,6-difluorophenyl)methyl]-7-(1,3-oxazol-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 146490904 |
| Molecular Formula | C21H16F2N8O |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 8-(2-amino-6-methyl-4-pyridinyl)-2-[(2,6-difluorophenyl)methyl]-7-(1,3-oxazol-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
| SMILES | Cc1cc(-c2c(-c3ncco3)nc(N)n3nc(Cc4c(F)cccc4F)nc23)cc(N)n1 |
| InChI | InChI=1S/C21H16F2N8O/c1-10-7-11(8-15(24)27-10)17-18(20-26-5-6-32-20)29-21(25)31-19(17)28-16(30-31)9-12-13(22)3-2-4-14(12)23/h2-8H,9H2,1H3,(H2,24,27)(H2,25,29) |
| InChIKey | RLIVWVXEZVEFKJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |