C26H24F4N6O — CID 146491566
[5,7-diethyl-2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-[1-(3-fluorophenyl)-1,2,4-triazol-3-yl]methanone (PubChem CID 146491566) has the molecular formula C26H24F4N6O and a molecular weight of 512.51 g/mol. Its IUPAC name is [5,7-diethyl-2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-[1-(3-fluorophenyl)-1,2,4-triazol-3-yl]methanone.
| Compound Name | [5,7-diethyl-2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-[1-(3-fluorophenyl)-1,2,4-triazol-3-yl]methanone |
|---|---|
| PubChem CID | 146491566 |
| Molecular Formula | C26H24F4N6O |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | [5,7-diethyl-2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-[1-(3-fluorophenyl)-1,2,4-triazol-3-yl]methanone |
| SMILES | CCC1Cc2c(nn(C)c2-c2cc(F)c(F)c(F)c2)C(CC)N1C(=O)c1ncn(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C26H24F4N6O/c1-4-16-12-18-23(32-34(3)24(18)14-9-19(28)22(30)20(29)10-14)21(5-2)36(16)26(37)25-31-13-35(33-25)17-8-6-7-15(27)11-17/h6-11,13,16,21H,4-5,12H2,1-3H3 |
| InChIKey | AMRJHHFCMZZMRW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|