C10H13F3N2O3S — CID 146491588
(2-methyl-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrazol-3-yl) trifluoromethanesulfonate (PubChem CID 146491588) has the molecular formula C10H13F3N2O3S and a molecular weight of 298.29 g/mol. Its IUPAC name is (2-methyl-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrazol-3-yl) trifluoromethanesulfonate.
| Compound Name | (2-methyl-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrazol-3-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 146491588 |
| Molecular Formula | C10H13F3N2O3S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (2-methyl-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrazol-3-yl) trifluoromethanesulfonate |
| SMILES | Cn1nc2c(c1OS(=O)(=O)C(F)(F)F)CCCCC2 |
| InChI | InChI=1S/C10H13F3N2O3S/c1-15-9(18-19(16,17)10(11,12)13)7-5-3-2-4-6-8(7)14-15/h2-6H2,1H3 |
| InChIKey | TZYATAJVZADBIK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|