C10H14N4 — CID 146491798
(1E,3Z,5Z)-1-(3-methyl-1,2,4-triazol-1-yl)hepta-1,3,5-trien-1-amine (PubChem CID 146491798) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is (1E,3Z,5Z)-1-(3-methyl-1,2,4-triazol-1-yl)hepta-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z,5Z)-1-(3-methyl-1,2,4-triazol-1-yl)hepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 146491798 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (1E,3Z,5Z)-1-(3-methyl-1,2,4-triazol-1-yl)hepta-1,3,5-trien-1-amine |
| SMILES | C/C=C\C=C/C=C(\N)n1cnc(C)n1 |
| InChI | InChI=1S/C10H14N4/c1-3-4-5-6-7-10(11)14-8-12-9(2)13-14/h3-8H,11H2,1-2H3/b4-3-,6-5-,10-7+ |
| InChIKey | ROSUPNUMELULCM-PZOXCDAASA-N |
| XLogP | 1.48 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|