C17H16F3N3 — CID 146491818
(1S,8S)-4,10-dimethyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatetracyclo[6.3.1.02,6.010,12]dodeca-2,5-diene (PubChem CID 146491818) has the molecular formula C17H16F3N3 and a molecular weight of 319.33 g/mol. Its IUPAC name is (1S,8S)-4,10-dimethyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatetracyclo[6.3.1.02,6.010,12]dodeca-2,5-diene.
| Compound Name | (1S,8S)-4,10-dimethyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatetracyclo[6.3.1.02,6.010,12]dodeca-2,5-diene |
|---|---|
| PubChem CID | 146491818 |
| Molecular Formula | C17H16F3N3 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (1S,8S)-4,10-dimethyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatetracyclo[6.3.1.02,6.010,12]dodeca-2,5-diene |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)C[C@H]1CC3(C)C[C@@H]2N13 |
| InChI | InChI=1S/C17H16F3N3/c1-17-6-9-5-10-15(13(7-17)23(9)17)21-22(2)16(10)8-3-11(18)14(20)12(19)4-8/h3-4,9,13H,5-7H2,1-2H3/t9-,13-,17?/m0/s1 |
| InChIKey | UFOVDDLXFNRNRC-ZDMKMVFXSA-N |
| XLogP | 3.34 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|