C23H35N3O4 — CID 146492011
5-(3-aminocyclodecyl)-2-(2,6-dioxopiperidin-3-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 146492011) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is 5-(3-aminocyclodecyl)-2-(2,6-dioxopiperidin-3-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 5-(3-aminocyclodecyl)-2-(2,6-dioxopiperidin-3-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 146492011 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 5-(3-aminocyclodecyl)-2-(2,6-dioxopiperidin-3-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | NC1CCCCCCCC(C2CCC3C(=O)N(C4CCC(=O)NC4=O)C(=O)C3C2)C1 |
| InChI | InChI=1S/C23H35N3O4/c24-16-7-5-3-1-2-4-6-14(12-16)15-8-9-17-18(13-15)23(30)26(22(17)29)19-10-11-20(27)25-21(19)28/h14-19H,1-13,24H2,(H,25,27,28) |
| InChIKey | VVWSXNTVWHYKCF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|