C12H19F3N2O2S — CID 146492063
1-[(2E,4Z)-hexa-2,4-dienyl]-4-(2,2,2-trifluoroethylsulfonyl)piperazine (PubChem CID 146492063) has the molecular formula C12H19F3N2O2S and a molecular weight of 312.36 g/mol. Its IUPAC name is 1-[(2E,4Z)-hexa-2,4-dienyl]-4-(2,2,2-trifluoroethylsulfonyl)piperazine.
| Compound Name | 1-[(2E,4Z)-hexa-2,4-dienyl]-4-(2,2,2-trifluoroethylsulfonyl)piperazine |
|---|---|
| PubChem CID | 146492063 |
| Molecular Formula | C12H19F3N2O2S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-[(2E,4Z)-hexa-2,4-dienyl]-4-(2,2,2-trifluoroethylsulfonyl)piperazine |
| SMILES | C/C=C\C=C\CN1CCN(S(=O)(=O)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H19F3N2O2S/c1-2-3-4-5-6-16-7-9-17(10-8-16)20(18,19)11-12(13,14)15/h2-5H,6-11H2,1H3/b3-2-,5-4+ |
| InChIKey | MRZPECAAXYEFSV-AWYLAFAOSA-N |
| XLogP | 1.63 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|