C49H46N2 — CID 146492274
N-[4-[(4E,6E)-7-[cyclohepta-1,4,6-trien-1-yl(naphthalen-1-yl)amino]octa-1,4,6-trien-4-yl]cyclohepta-1,3,6-trien-1-yl]-N-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]naphthalen-1-amine (PubChem CID 146492274) has the molecular formula C49H46N2 and a molecular weight of 662.92 g/mol. Its IUPAC name is N-[4-[(4E,6E)-7-[cyclohepta-1,4,6-trien-1-yl(naphthalen-1-yl)amino]octa-1,4,6-trien-4-yl]cyclohepta-1,3,6-trien-1-yl]-N-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]naphthalen-1-amine.
| Compound Name | N-[4-[(4E,6E)-7-[cyclohepta-1,4,6-trien-1-yl(naphthalen-1-yl)amino]octa-1,4,6-trien-4-yl]cyclohepta-1,3,6-trien-1-yl]-N-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 146492274 |
| Molecular Formula | C49H46N2 |
| Molecular Weight | 662.92 g/mol |
| Exact Mass | 662.37 |
| IUPAC Name | N-[4-[(4E,6E)-7-[cyclohepta-1,4,6-trien-1-yl(naphthalen-1-yl)amino]octa-1,4,6-trien-4-yl]cyclohepta-1,3,6-trien-1-yl]-N-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]naphthalen-1-amine |
| SMILES | C=CC/C(=C\C=C(/C)N(C1=CCC=CC=C1)c1cccc2ccccc12)C1=CC=C(N(/C=C/C=C\C=C/C)c2cccc3ccccc23)C=CC1 |
| InChI | InChI=1S/C49H46N2/c1-4-6-7-10-17-38-50(48-32-19-25-42-22-13-15-30-46(42)48)44-29-18-24-41(36-37-44)40(21-5-2)35-34-39(3)51(45-27-11-8-9-12-28-45)49-33-20-26-43-23-14-16-31-47(43)49/h4-11,13-20,22-23,25-38H,2,12,21,24H2,1,3H3/b6-4-,10-7-,38-17+,39-34+,40-35+ |
| InChIKey | PUNPRKYVMUNHBV-PHTIHBCMSA-N |
| XLogP | 13.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.92 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|