C12H23NS — CID 146492315
5,6-ditert-butyl-3,4-dihydro-2H-1,4-thiazine (PubChem CID 146492315) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is 5,6-ditert-butyl-3,4-dihydro-2H-1,4-thiazine.
| Compound Name | 5,6-ditert-butyl-3,4-dihydro-2H-1,4-thiazine |
|---|---|
| PubChem CID | 146492315 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 5,6-ditert-butyl-3,4-dihydro-2H-1,4-thiazine |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)SCCN1 |
| InChI | InChI=1S/C12H23NS/c1-11(2,3)9-10(12(4,5)6)14-8-7-13-9/h13H,7-8H2,1-6H3 |
| InChIKey | ZAESTVFLXCITSK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |