C16H23N — CID 146492350
(4Z,6Z,9Z,11Z)-N-methyl-8-methylidenetetradeca-4,6,9,11,13-pentaen-2-amine (PubChem CID 146492350) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is (4Z,6Z,9Z,11Z)-N-methyl-8-methylidenetetradeca-4,6,9,11,13-pentaen-2-amine.
| Compound Name | (4Z,6Z,9Z,11Z)-N-methyl-8-methylidenetetradeca-4,6,9,11,13-pentaen-2-amine |
|---|---|
| PubChem CID | 146492350 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (4Z,6Z,9Z,11Z)-N-methyl-8-methylidenetetradeca-4,6,9,11,13-pentaen-2-amine |
| SMILES | C=C/C=C\C=C/C(=C)/C=C\C=C/CC(C)NC |
| InChI | InChI=1S/C16H23N/c1-5-6-7-9-12-15(2)13-10-8-11-14-16(3)17-4/h5-13,16-17H,1-2,14H2,3-4H3/b7-6-,11-8-,12-9-,13-10- |
| InChIKey | MUIDVHPWOWYFFU-YSHOEMLNSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|