C21H35N — CID 146492399
(Z)-N-(1,4-diethyl-4-methylcyclobut-2-en-1-yl)-3,3,4-trimethyl-2-methylideneoct-5-en-1-imine (PubChem CID 146492399) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is (Z)-N-(1,4-diethyl-4-methylcyclobut-2-en-1-yl)-3,3,4-trimethyl-2-methylideneoct-5-en-1-imine.
| Compound Name | (Z)-N-(1,4-diethyl-4-methylcyclobut-2-en-1-yl)-3,3,4-trimethyl-2-methylideneoct-5-en-1-imine |
|---|---|
| PubChem CID | 146492399 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | (Z)-N-(1,4-diethyl-4-methylcyclobut-2-en-1-yl)-3,3,4-trimethyl-2-methylideneoct-5-en-1-imine |
| SMILES | C=C(/C=N/C1(CC)C=CC1(C)CC)C(C)(C)C(C)/C=C\CC |
| InChI | InChI=1S/C21H35N/c1-9-12-13-17(4)19(6,7)18(5)16-22-21(11-3)15-14-20(21,8)10-2/h12-17H,5,9-11H2,1-4,6-8H3/b13-12-,22-16+ |
| InChIKey | GBVPUGWIXUKWHK-LZBRKGMLSA-N |
| XLogP | 6.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|