C13H17Br2N — CID 146492428
1,5-dibromo-6-butan-2-yl-1,2,4a,5-tetrahydroisoquinoline (PubChem CID 146492428) has the molecular formula C13H17Br2N and a molecular weight of 347.09 g/mol. Its IUPAC name is 1,5-dibromo-6-butan-2-yl-1,2,4a,5-tetrahydroisoquinoline.
| Compound Name | 1,5-dibromo-6-butan-2-yl-1,2,4a,5-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 146492428 |
| Molecular Formula | C13H17Br2N |
| Molecular Weight | 347.09 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 1,5-dibromo-6-butan-2-yl-1,2,4a,5-tetrahydroisoquinoline |
| SMILES | CCC(C)C1=CC=C2C(Br)NC=CC2C1Br |
| InChI | InChI=1S/C13H17Br2N/c1-3-8(2)9-4-5-11-10(12(9)14)6-7-16-13(11)15/h4-8,10,12-13,16H,3H2,1-2H3 |
| InChIKey | AJHOZILZSVZUMK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.09 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|