About (Z)-N'-(cyclopentylmethyl)-N'-ethyl-2-methanimidoyl-3-methylbut-1-ene-1,4-diamine
(Z)-N'-(cyclopentylmethyl)-N'-ethyl-2-methanimidoyl-3-methylbut-1-ene-1,4-diamine (PubChem CID 146492444) has the molecular formula C14H27N3
and a molecular weight of 237.39 g/mol. Its IUPAC name is (Z)-N'-(cyclopentylmethyl)-N'-ethyl-2-methanimidoyl-3-methylbut-1-ene-1,4-diamine.
Molecular Properties
| Compound Name | (Z)-N'-(cyclopentylmethyl)-N'-ethyl-2-methanimidoyl-3-methylbut-1-ene-1,4-diamine |
| PubChem CID | 146492444 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | (Z)-N'-(cyclopentylmethyl)-N'-ethyl-2-methanimidoyl-3-methylbut-1-ene-1,4-diamine |
| SMILES | [H]/N=C/C(=C\N)C(C)CN(CC)CC1CCCC1 |
| InChI | InChI=1S/C14H27N3/c1-3-17(11-13-6-4-5-7-13)10-12(2)14(8-15)9-16/h8-9,12-13,15H,3-7,10-11,16H2,1-2H3/b14-9+,15-8+ |
| InChIKey | AKOIBVZULNPSLB-LPSKSUNQSA-N |
| XLogP | 2.63 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N'-(cyclopentylmethyl)-N'-ethyl-2-methanimidoyl-3-methylbut-1-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-(cyclopentylmethyl)-N'-ethyl-2-methanimidoyl-3-methylbut-1-ene-1,4-diamine?
The IUPAC name of (Z)-N'-(cyclopentylmethyl)-N'-ethyl-2-methanimidoyl-3-methylbut-1-ene-1,4-diamine (CID 146492444) is (Z)-N'-(cyclopentylmethyl)-N'-ethyl-2-methanimidoyl-3-methylbut-1-ene-1,4-diamine.
What is the SMILES notation for (Z)-N'-(cyclopentylmethyl)-N'-ethyl-2-methanimidoyl-3-methylbut-1-ene-1,4-diamine?
The canonical SMILES for (Z)-N'-(cyclopentylmethyl)-N'-ethyl-2-methanimidoyl-3-methylbut-1-ene-1,4-diamine is [H]/N=C/C(=C\N)C(C)CN(CC)CC1CCCC1.
What is the InChIKey of (Z)-N'-(cyclopentylmethyl)-N'-ethyl-2-methanimidoyl-3-methylbut-1-ene-1,4-diamine?
The InChIKey is AKOIBVZULNPSLB-LPSKSUNQSA-N. The full InChI is InChI=1S/C14H27N3/c1-3-17(11-13-6-4-5-7-13)10-12(2)14(8-15)9-16/h8-9,12-13,15H,3-7,10-11,16H2,1-2H3/b14-9+,15-8+.
What are the key properties of (Z)-N'-(cyclopentylmethyl)-N'-ethyl-2-methanimidoyl-3-methylbut-1-ene-1,4-diamine?
(Z)-N'-(cyclopentylmethyl)-N'-ethyl-2-methanimidoyl-3-methylbut-1-ene-1,4-diamine has a molecular weight of 237.39 g/mol, XLogP of 2.63, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-(cyclopentylmethyl)-N'-ethyl-2-methanimidoyl-3-methylbut-1-ene-1,4-diamine is sourced from PubChem (CID 146492444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).