About 4-cyclohexyl-3-methylcyclohexa-1,5-dien-1-amine
4-cyclohexyl-3-methylcyclohexa-1,5-dien-1-amine (PubChem CID 146492465) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 4-cyclohexyl-3-methylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 4-cyclohexyl-3-methylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 146492465 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 4-cyclohexyl-3-methylcyclohexa-1,5-dien-1-amine |
| SMILES | CC1C=C(N)C=CC1C1CCCCC1 |
| InChI | InChI=1S/C13H21N/c1-10-9-12(14)7-8-13(10)11-5-3-2-4-6-11/h7-11,13H,2-6,14H2,1H3 |
| InChIKey | FZNLBAPFXDILSM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclohexyl-3-methylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-3-methylcyclohexa-1,5-dien-1-amine?
The IUPAC name of 4-cyclohexyl-3-methylcyclohexa-1,5-dien-1-amine (CID 146492465) is 4-cyclohexyl-3-methylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 4-cyclohexyl-3-methylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for 4-cyclohexyl-3-methylcyclohexa-1,5-dien-1-amine is CC1C=C(N)C=CC1C1CCCCC1.
What is the InChIKey of 4-cyclohexyl-3-methylcyclohexa-1,5-dien-1-amine?
The InChIKey is FZNLBAPFXDILSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-10-9-12(14)7-8-13(10)11-5-3-2-4-6-11/h7-11,13H,2-6,14H2,1H3.
What are the key properties of 4-cyclohexyl-3-methylcyclohexa-1,5-dien-1-amine?
4-cyclohexyl-3-methylcyclohexa-1,5-dien-1-amine has a molecular weight of 191.32 g/mol, XLogP of 3.23, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-3-methylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 146492465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).