About [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylpropanoate
[5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylpropanoate (PubChem CID 146492797) has the molecular formula C11H14F6O3
and a molecular weight of 308.22 g/mol. Its IUPAC name is [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylpropanoate |
| PubChem CID | 146492797 |
| Molecular Formula | C11H14F6O3 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1CCC(C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C11H14F6O3/c1-8(2,3)7(18)19-6-4-5-9(20-6,10(12,13)14)11(15,16)17/h6H,4-5H2,1-3H3 |
| InChIKey | CCVZPWILPROXML-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylpropanoate?
The IUPAC name of [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylpropanoate (CID 146492797) is [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylpropanoate.
What is the SMILES notation for [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylpropanoate?
The canonical SMILES for [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylpropanoate is CC(C)(C)C(=O)OC1CCC(C(F)(F)F)(C(F)(F)F)O1.
What is the InChIKey of [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylpropanoate?
The InChIKey is CCVZPWILPROXML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F6O3/c1-8(2,3)7(18)19-6-4-5-9(20-6,10(12,13)14)11(15,16)17/h6H,4-5H2,1-3H3.
What are the key properties of [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylpropanoate?
[5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylpropanoate has a molecular weight of 308.22 g/mol, XLogP of 3.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylpropanoate is sourced from PubChem (CID 146492797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).